C26H37N5O — CID 111634185
3-[2-[[N-ethyl-N'-[2-(4-methylphenyl)-2-pyrrolidin-1-ylethyl]carbamimidoyl]amino]ethyl]-N-methylbenzamide (PubChem CID 111634185) has the molecular formula C26H37N5O and a molecular weight of 435.62 g/mol. Its IUPAC name is 3-[2-[[N-ethyl-N'-[2-(4-methylphenyl)-2-pyrrolidin-1-ylethyl]carbamimidoyl]amino]ethyl]-N-methylbenzamide.
| Compound Name | 3-[2-[[N-ethyl-N'-[2-(4-methylphenyl)-2-pyrrolidin-1-ylethyl]carbamimidoyl]amino]ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 111634185 |
| Molecular Formula | C26H37N5O |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 435.30 |
| IUPAC Name | 3-[2-[[N-ethyl-N'-[2-(4-methylphenyl)-2-pyrrolidin-1-ylethyl]carbamimidoyl]amino]ethyl]-N-methylbenzamide |
| SMILES | CCN/C(=N\CC(c1ccc(C)cc1)N1CCCC1)NCCc1cccc(C(=O)NC)c1 |
| InChI | InChI=1S/C26H37N5O/c1-4-28-26(29-15-14-21-8-7-9-23(18-21)25(32)27-3)30-19-24(31-16-5-6-17-31)22-12-10-20(2)11-13-22/h7-13,18,24H,4-6,14-17,19H2,1-3H3,(H,27,32)(H2,28,29,30) |
| InChIKey | GVXBIXPGOAIYJW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|