C22H38N6O — CID 111633215
3-[2-[[N-ethyl-N'-[2-(4-ethylpiperazin-1-yl)propyl]carbamimidoyl]amino]ethyl]-N-methylbenzamide (PubChem CID 111633215) has the molecular formula C22H38N6O and a molecular weight of 402.59 g/mol. Its IUPAC name is 3-[2-[[N-ethyl-N'-[2-(4-ethylpiperazin-1-yl)propyl]carbamimidoyl]amino]ethyl]-N-methylbenzamide.
| Compound Name | 3-[2-[[N-ethyl-N'-[2-(4-ethylpiperazin-1-yl)propyl]carbamimidoyl]amino]ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 111633215 |
| Molecular Formula | C22H38N6O |
| Molecular Weight | 402.59 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | 3-[2-[[N-ethyl-N'-[2-(4-ethylpiperazin-1-yl)propyl]carbamimidoyl]amino]ethyl]-N-methylbenzamide |
| SMILES | CCN/C(=N\CC(C)N1CCN(CC)CC1)NCCc1cccc(C(=O)NC)c1 |
| InChI | InChI=1S/C22H38N6O/c1-5-24-22(26-17-18(3)28-14-12-27(6-2)13-15-28)25-11-10-19-8-7-9-20(16-19)21(29)23-4/h7-9,16,18H,5-6,10-15,17H2,1-4H3,(H,23,29)(H2,24,25,26) |
| InChIKey | ZYNDCLACKOCPME-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.59 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|