C27H39N5O — CID 111670116
3-[2-[[N-ethyl-N'-[2-(4-methylphenyl)-2-pyrrolidin-1-ylethyl]carbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide (PubChem CID 111670116) has the molecular formula C27H39N5O and a molecular weight of 449.64 g/mol. Its IUPAC name is 3-[2-[[N-ethyl-N'-[2-(4-methylphenyl)-2-pyrrolidin-1-ylethyl]carbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[2-[[N-ethyl-N'-[2-(4-methylphenyl)-2-pyrrolidin-1-ylethyl]carbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 111670116 |
| Molecular Formula | C27H39N5O |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.32 |
| IUPAC Name | 3-[2-[[N-ethyl-N'-[2-(4-methylphenyl)-2-pyrrolidin-1-ylethyl]carbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide |
| SMILES | CCN/C(=N\CC(c1ccc(C)cc1)N1CCCC1)NCCc1cccc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C27H39N5O/c1-5-28-27(29-16-15-22-9-8-10-24(19-22)26(33)31(3)4)30-20-25(32-17-6-7-18-32)23-13-11-21(2)12-14-23/h8-14,19,25H,5-7,15-18,20H2,1-4H3,(H2,28,29,30) |
| InChIKey | NFCLOBKTLHNUFR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|