C23H39N5O2 — CID 111632306
3-[2-[[N'-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide (PubChem CID 111632306) has the molecular formula C23H39N5O2 and a molecular weight of 417.60 g/mol. Its IUPAC name is 3-[2-[[N'-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide.
| Compound Name | 3-[2-[[N'-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 111632306 |
| Molecular Formula | C23H39N5O2 |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.31 |
| IUPAC Name | 3-[2-[[N'-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide |
| SMILES | CCN/C(=N\CC(C)(C)N1CC(C)OC(C)C1)NCCc1cccc(C(=O)NC)c1 |
| InChI | InChI=1S/C23H39N5O2/c1-7-25-22(26-12-11-19-9-8-10-20(13-19)21(29)24-6)27-16-23(4,5)28-14-17(2)30-18(3)15-28/h8-10,13,17-18H,7,11-12,14-16H2,1-6H3,(H,24,29)(H2,25,26,27) |
| InChIKey | CGVSPOBQKCWSFW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|