C22H33FIN5 — CID 109404138
2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-ethyl-3-[[1-(3-fluorophenyl)cyclopropyl]methyl]guanidine;hydroiodide (PubChem CID 109404138) has the molecular formula C22H33FIN5 and a molecular weight of 513.44 g/mol. Its IUPAC name is 2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-ethyl-3-[[1-(3-fluorophenyl)cyclopropyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-ethyl-3-[[1-(3-fluorophenyl)cyclopropyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109404138 |
| Molecular Formula | C22H33FIN5 |
| Molecular Weight | 513.44 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | 2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-ethyl-3-[[1-(3-fluorophenyl)cyclopropyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1c(CC)nn(C)c1CC)NCC1(c2cccc(F)c2)CC1.I |
| InChI | InChI=1S/C22H32FN5.HI/c1-5-19-18(20(6-2)28(4)27-19)14-25-21(24-7-3)26-15-22(11-12-22)16-9-8-10-17(23)13-16;/h8-10,13H,5-7,11-12,14-15H2,1-4H3,(H2,24,25,26);1H |
| InChIKey | ATZBMQAZMQMBGD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|