C23H32FIN4 — CID 111639443
2-[[2-[(dimethylamino)methyl]phenyl]methyl]-1-ethyl-3-[[1-(3-fluorophenyl)cyclopropyl]methyl]guanidine;hydroiodide (PubChem CID 111639443) has the molecular formula C23H32FIN4 and a molecular weight of 510.44 g/mol. Its IUPAC name is 2-[[2-[(dimethylamino)methyl]phenyl]methyl]-1-ethyl-3-[[1-(3-fluorophenyl)cyclopropyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-[[2-[(dimethylamino)methyl]phenyl]methyl]-1-ethyl-3-[[1-(3-fluorophenyl)cyclopropyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111639443 |
| Molecular Formula | C23H32FIN4 |
| Molecular Weight | 510.44 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | 2-[[2-[(dimethylamino)methyl]phenyl]methyl]-1-ethyl-3-[[1-(3-fluorophenyl)cyclopropyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1CN(C)C)NCC1(c2cccc(F)c2)CC1.I |
| InChI | InChI=1S/C23H31FN4.HI/c1-4-25-22(26-15-18-8-5-6-9-19(18)16-28(2)3)27-17-23(12-13-23)20-10-7-11-21(24)14-20;/h5-11,14H,4,12-13,15-17H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | GTKSMMJJPWRHKR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|