C22H27ClN4O — CID 111875245
4-[[[N-[[1-(4-chlorophenyl)cyclopropyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylbenzamide (PubChem CID 111875245) has the molecular formula C22H27ClN4O and a molecular weight of 398.94 g/mol. Its IUPAC name is 4-[[[N-[[1-(4-chlorophenyl)cyclopropyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[[[N-[[1-(4-chlorophenyl)cyclopropyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 111875245 |
| Molecular Formula | C22H27ClN4O |
| Molecular Weight | 398.94 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 4-[[[N-[[1-(4-chlorophenyl)cyclopropyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylbenzamide |
| SMILES | C/N=C(\NCc1ccc(C(=O)N(C)C)cc1)NCC1(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C22H27ClN4O/c1-24-21(25-14-16-4-6-17(7-5-16)20(28)27(2)3)26-15-22(12-13-22)18-8-10-19(23)11-9-18/h4-11H,12-15H2,1-3H3,(H2,24,25,26) |
| InChIKey | CYOCHRRMPQGTIA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.94 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|