C23H28F3IN4O — CID 111875242
N,N-dimethyl-4-[[[N'-methyl-N-[[1-[3-(trifluoromethyl)phenyl]cyclopropyl]methyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide (PubChem CID 111875242) has the molecular formula C23H28F3IN4O and a molecular weight of 560.40 g/mol. Its IUPAC name is N,N-dimethyl-4-[[[N'-methyl-N-[[1-[3-(trifluoromethyl)phenyl]cyclopropyl]methyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide.
| Compound Name | N,N-dimethyl-4-[[[N'-methyl-N-[[1-[3-(trifluoromethyl)phenyl]cyclopropyl]methyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111875242 |
| Molecular Formula | C23H28F3IN4O |
| Molecular Weight | 560.40 g/mol |
| Exact Mass | 560.13 |
| IUPAC Name | N,N-dimethyl-4-[[[N'-methyl-N-[[1-[3-(trifluoromethyl)phenyl]cyclopropyl]methyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(C(=O)N(C)C)cc1)NCC1(c2cccc(C(F)(F)F)c2)CC1.I |
| InChI | InChI=1S/C23H27F3N4O.HI/c1-27-21(28-14-16-7-9-17(10-8-16)20(31)30(2)3)29-15-22(11-12-22)18-5-4-6-19(13-18)23(24,25)26;/h4-10,13H,11-12,14-15H2,1-3H3,(H2,27,28,29);1H |
| InChIKey | LPFCHLVUINAXRT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|