C18H22F3IN4S — CID 111525171
2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[[1-[3-(trifluoromethyl)phenyl]cyclopropyl]methyl]guanidine;hydroiodide (PubChem CID 111525171) has the molecular formula C18H22F3IN4S and a molecular weight of 510.37 g/mol. Its IUPAC name is 2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[[1-[3-(trifluoromethyl)phenyl]cyclopropyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[[1-[3-(trifluoromethyl)phenyl]cyclopropyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111525171 |
| Molecular Formula | C18H22F3IN4S |
| Molecular Weight | 510.37 g/mol |
| Exact Mass | 510.06 |
| IUPAC Name | 2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[[1-[3-(trifluoromethyl)phenyl]cyclopropyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ncc(C)s1)NCC1(c2cccc(C(F)(F)F)c2)CC1.I |
| InChI | InChI=1S/C18H21F3N4S.HI/c1-12-9-23-15(26-12)10-24-16(22-2)25-11-17(6-7-17)13-4-3-5-14(8-13)18(19,20)21;/h3-5,8-9H,6-7,10-11H2,1-2H3,(H2,22,24,25);1H |
| InChIKey | HCYKVLVQFJQIIR-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.37 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|