C19H28F3N3O — CID 111946315
1-(4-ethoxybutyl)-2-methyl-3-[[1-[3-(trifluoromethyl)phenyl]cyclopropyl]methyl]guanidine (PubChem CID 111946315) has the molecular formula C19H28F3N3O and a molecular weight of 371.45 g/mol. Its IUPAC name is 1-(4-ethoxybutyl)-2-methyl-3-[[1-[3-(trifluoromethyl)phenyl]cyclopropyl]methyl]guanidine.
| Compound Name | 1-(4-ethoxybutyl)-2-methyl-3-[[1-[3-(trifluoromethyl)phenyl]cyclopropyl]methyl]guanidine |
|---|---|
| PubChem CID | 111946315 |
| Molecular Formula | C19H28F3N3O |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 1-(4-ethoxybutyl)-2-methyl-3-[[1-[3-(trifluoromethyl)phenyl]cyclopropyl]methyl]guanidine |
| SMILES | CCOCCCCN/C(=N\C)NCC1(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H28F3N3O/c1-3-26-12-5-4-11-24-17(23-2)25-14-18(9-10-18)15-7-6-8-16(13-15)19(20,21)22/h6-8,13H,3-5,9-12,14H2,1-2H3,(H2,23,24,25) |
| InChIKey | UQRMXOLDILMIOB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|