C22H32F3N3O2 — CID 111644422
2-methyl-1-[3-(oxan-4-ylmethoxy)propyl]-3-[[1-[3-(trifluoromethyl)phenyl]cyclopropyl]methyl]guanidine (PubChem CID 111644422) has the molecular formula C22H32F3N3O2 and a molecular weight of 427.51 g/mol. Its IUPAC name is 2-methyl-1-[3-(oxan-4-ylmethoxy)propyl]-3-[[1-[3-(trifluoromethyl)phenyl]cyclopropyl]methyl]guanidine.
| Compound Name | 2-methyl-1-[3-(oxan-4-ylmethoxy)propyl]-3-[[1-[3-(trifluoromethyl)phenyl]cyclopropyl]methyl]guanidine |
|---|---|
| PubChem CID | 111644422 |
| Molecular Formula | C22H32F3N3O2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 2-methyl-1-[3-(oxan-4-ylmethoxy)propyl]-3-[[1-[3-(trifluoromethyl)phenyl]cyclopropyl]methyl]guanidine |
| SMILES | C/N=C(\NCCCOCC1CCOCC1)NCC1(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C22H32F3N3O2/c1-26-20(27-10-3-11-30-15-17-6-12-29-13-7-17)28-16-21(8-9-21)18-4-2-5-19(14-18)22(23,24)25/h2,4-5,14,17H,3,6-13,15-16H2,1H3,(H2,26,27,28) |
| InChIKey | JPADRSPXCWARBT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|