C27H28FNO2 — CID 27456804
N-(3,3-diphenylpropyl)-4-(4-fluorophenyl)oxane-4-carboxamide (PubChem CID 27456804) has the molecular formula C27H28FNO2 and a molecular weight of 417.52 g/mol. Its IUPAC name is N-(3,3-diphenylpropyl)-4-(4-fluorophenyl)oxane-4-carboxamide.
| Compound Name | N-(3,3-diphenylpropyl)-4-(4-fluorophenyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 27456804 |
| Molecular Formula | C27H28FNO2 |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | N-(3,3-diphenylpropyl)-4-(4-fluorophenyl)oxane-4-carboxamide |
| SMILES | O=C(NCCC(c1ccccc1)c1ccccc1)C1(c2ccc(F)cc2)CCOCC1 |
| InChI | InChI=1S/C27H28FNO2/c28-24-13-11-23(12-14-24)27(16-19-31-20-17-27)26(30)29-18-15-25(21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1-14,25H,15-20H2,(H,29,30) |
| InChIKey | UUZHJRYBECAYGI-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |