C21H25NO3 — CID 96568311
N-[(3R)-3-hydroxy-3-phenylpropyl]-4-phenyloxane-4-carboxamide (PubChem CID 96568311) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-[(3R)-3-hydroxy-3-phenylpropyl]-4-phenyloxane-4-carboxamide.
| Compound Name | N-[(3R)-3-hydroxy-3-phenylpropyl]-4-phenyloxane-4-carboxamide |
|---|---|
| PubChem CID | 96568311 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | N-[(3R)-3-hydroxy-3-phenylpropyl]-4-phenyloxane-4-carboxamide |
| SMILES | O=C(NCC[C@@H](O)c1ccccc1)C1(c2ccccc2)CCOCC1 |
| InChI | InChI=1S/C21H25NO3/c23-19(17-7-3-1-4-8-17)11-14-22-20(24)21(12-15-25-16-13-21)18-9-5-2-6-10-18/h1-10,19,23H,11-16H2,(H,22,24)/t19-/m1/s1 |
| InChIKey | BVQSETNQEIHOKZ-LJQANCHMSA-N |
| XLogP | 2.97 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |