C29H36N2O4 — CID 60615517
N-[2-cyclopropyl-2-[(4-phenyloxane-4-carbonyl)amino]ethyl]-4-phenyloxane-4-carboxamide (PubChem CID 60615517) has the molecular formula C29H36N2O4 and a molecular weight of 476.62 g/mol. Its IUPAC name is N-[2-cyclopropyl-2-[(4-phenyloxane-4-carbonyl)amino]ethyl]-4-phenyloxane-4-carboxamide.
| Compound Name | N-[2-cyclopropyl-2-[(4-phenyloxane-4-carbonyl)amino]ethyl]-4-phenyloxane-4-carboxamide |
|---|---|
| PubChem CID | 60615517 |
| Molecular Formula | C29H36N2O4 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | N-[2-cyclopropyl-2-[(4-phenyloxane-4-carbonyl)amino]ethyl]-4-phenyloxane-4-carboxamide |
| SMILES | O=C(NCC(NC(=O)C1(c2ccccc2)CCOCC1)C1CC1)C1(c2ccccc2)CCOCC1 |
| InChI | InChI=1S/C29H36N2O4/c32-26(28(13-17-34-18-14-28)23-7-3-1-4-8-23)30-21-25(22-11-12-22)31-27(33)29(15-19-35-20-16-29)24-9-5-2-6-10-24/h1-10,22,25H,11-21H2,(H,30,32)(H,31,33) |
| InChIKey | BBGZCLWKFGMJMY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |