C20H31ClN2O2 — CID 119591634
N-(2-amino-1-cyclohexylethyl)-4-phenyloxane-4-carboxamide;hydrochloride (PubChem CID 119591634) has the molecular formula C20H31ClN2O2 and a molecular weight of 366.93 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-4-phenyloxane-4-carboxamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-4-phenyloxane-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119591634 |
| Molecular Formula | C20H31ClN2O2 |
| Molecular Weight | 366.93 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-4-phenyloxane-4-carboxamide;hydrochloride |
| SMILES | Cl.NCC(NC(=O)C1(c2ccccc2)CCOCC1)C1CCCCC1 |
| InChI | InChI=1S/C20H30N2O2.ClH/c21-15-18(16-7-3-1-4-8-16)22-19(23)20(11-13-24-14-12-20)17-9-5-2-6-10-17;/h2,5-6,9-10,16,18H,1,3-4,7-8,11-15,21H2,(H,22,23);1H |
| InChIKey | IGRHFPQZGFIYPW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.93 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |