C23H25NO4 — CID 97414295
N-[(3S)-3-(1-benzofuran-2-yl)-3-hydroxypropyl]-4-phenyloxane-4-carboxamide (PubChem CID 97414295) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-[(3S)-3-(1-benzofuran-2-yl)-3-hydroxypropyl]-4-phenyloxane-4-carboxamide.
| Compound Name | N-[(3S)-3-(1-benzofuran-2-yl)-3-hydroxypropyl]-4-phenyloxane-4-carboxamide |
|---|---|
| PubChem CID | 97414295 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | N-[(3S)-3-(1-benzofuran-2-yl)-3-hydroxypropyl]-4-phenyloxane-4-carboxamide |
| SMILES | O=C(NCC[C@H](O)c1cc2ccccc2o1)C1(c2ccccc2)CCOCC1 |
| InChI | InChI=1S/C23H25NO4/c25-19(21-16-17-6-4-5-9-20(17)28-21)10-13-24-22(26)23(11-14-27-15-12-23)18-7-2-1-3-8-18/h1-9,16,19,25H,10-15H2,(H,24,26)/t19-/m0/s1 |
| InChIKey | RGNLULVRFVRVQR-IBGZPJMESA-N |
| XLogP | 3.72 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |