C16H14BrNO4 — CID 97414288
N-[(3S)-3-(1-benzofuran-2-yl)-3-hydroxypropyl]-5-bromofuran-2-carboxamide (PubChem CID 97414288) has the molecular formula C16H14BrNO4 and a molecular weight of 364.20 g/mol. Its IUPAC name is N-[(3S)-3-(1-benzofuran-2-yl)-3-hydroxypropyl]-5-bromofuran-2-carboxamide.
| Compound Name | N-[(3S)-3-(1-benzofuran-2-yl)-3-hydroxypropyl]-5-bromofuran-2-carboxamide |
|---|---|
| PubChem CID | 97414288 |
| Molecular Formula | C16H14BrNO4 |
| Molecular Weight | 364.20 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | N-[(3S)-3-(1-benzofuran-2-yl)-3-hydroxypropyl]-5-bromofuran-2-carboxamide |
| SMILES | O=C(NCC[C@H](O)c1cc2ccccc2o1)c1ccc(Br)o1 |
| InChI | InChI=1S/C16H14BrNO4/c17-15-6-5-13(22-15)16(20)18-8-7-11(19)14-9-10-3-1-2-4-12(10)21-14/h1-6,9,11,19H,7-8H2,(H,18,20)/t11-/m0/s1 |
| InChIKey | ZOISXXNKUDSJBZ-NSHDSACASA-N |
| XLogP | 3.64 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.20 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |