C14H14BrNO3 — CID 90499560
5-bromo-N-(3-hydroxy-3-phenylpropyl)furan-2-carboxamide (PubChem CID 90499560) has the molecular formula C14H14BrNO3 and a molecular weight of 324.17 g/mol. Its IUPAC name is 5-bromo-N-(3-hydroxy-3-phenylpropyl)furan-2-carboxamide.
| Compound Name | 5-bromo-N-(3-hydroxy-3-phenylpropyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 90499560 |
| Molecular Formula | C14H14BrNO3 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 5-bromo-N-(3-hydroxy-3-phenylpropyl)furan-2-carboxamide |
| SMILES | O=C(NCCC(O)c1ccccc1)c1ccc(Br)o1 |
| InChI | InChI=1S/C14H14BrNO3/c15-13-7-6-12(19-13)14(18)16-9-8-11(17)10-4-2-1-3-5-10/h1-7,11,17H,8-9H2,(H,16,18) |
| InChIKey | AZECOENMXMHCOP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |