C20H21BrFNO3 — CID 138993452
N-[(2S)-2-(3-bromophenyl)-2-hydroxyethyl]-4-(4-fluorophenyl)oxane-4-carboxamide (PubChem CID 138993452) has the molecular formula C20H21BrFNO3 and a molecular weight of 422.29 g/mol. Its IUPAC name is N-[(2S)-2-(3-bromophenyl)-2-hydroxyethyl]-4-(4-fluorophenyl)oxane-4-carboxamide.
| Compound Name | N-[(2S)-2-(3-bromophenyl)-2-hydroxyethyl]-4-(4-fluorophenyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 138993452 |
| Molecular Formula | C20H21BrFNO3 |
| Molecular Weight | 422.29 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | N-[(2S)-2-(3-bromophenyl)-2-hydroxyethyl]-4-(4-fluorophenyl)oxane-4-carboxamide |
| SMILES | O=C(NC[C@@H](O)c1cccc(Br)c1)C1(c2ccc(F)cc2)CCOCC1 |
| InChI | InChI=1S/C20H21BrFNO3/c21-16-3-1-2-14(12-16)18(24)13-23-19(25)20(8-10-26-11-9-20)15-4-6-17(22)7-5-15/h1-7,12,18,24H,8-11,13H2,(H,23,25)/t18-/m1/s1 |
| InChIKey | SJKCXTNGNNKJMP-GOSISDBHSA-N |
| XLogP | 3.49 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.29 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |