C21H24FN3O2 — CID 47042246
4-[(carbamoylamino)methyl]-N-[[1-(4-fluorophenyl)cyclopentyl]methyl]benzamide (PubChem CID 47042246) has the molecular formula C21H24FN3O2 and a molecular weight of 369.44 g/mol. Its IUPAC name is 4-[(carbamoylamino)methyl]-N-[[1-(4-fluorophenyl)cyclopentyl]methyl]benzamide.
| Compound Name | 4-[(carbamoylamino)methyl]-N-[[1-(4-fluorophenyl)cyclopentyl]methyl]benzamide |
|---|---|
| PubChem CID | 47042246 |
| Molecular Formula | C21H24FN3O2 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 4-[(carbamoylamino)methyl]-N-[[1-(4-fluorophenyl)cyclopentyl]methyl]benzamide |
| SMILES | NC(=O)NCc1ccc(C(=O)NCC2(c3ccc(F)cc3)CCCC2)cc1 |
| InChI | InChI=1S/C21H24FN3O2/c22-18-9-7-17(8-10-18)21(11-1-2-12-21)14-25-19(26)16-5-3-15(4-6-16)13-24-20(23)27/h3-10H,1-2,11-14H2,(H,25,26)(H3,23,24,27) |
| InChIKey | ANPUPXFOTRXMQQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |