C22H26FNO2 — CID 27450093
N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-4-propylbenzamide (PubChem CID 27450093) has the molecular formula C22H26FNO2 and a molecular weight of 355.45 g/mol. Its IUPAC name is N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-4-propylbenzamide.
| Compound Name | N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-4-propylbenzamide |
|---|---|
| PubChem CID | 27450093 |
| Molecular Formula | C22H26FNO2 |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-4-propylbenzamide |
| SMILES | CCCc1ccc(C(=O)NCC2(c3ccc(F)cc3)CCOCC2)cc1 |
| InChI | InChI=1S/C22H26FNO2/c1-2-3-17-4-6-18(7-5-17)21(25)24-16-22(12-14-26-15-13-22)19-8-10-20(23)11-9-19/h4-11H,2-3,12-16H2,1H3,(H,24,25) |
| InChIKey | ASAKYQVRWVQTCN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |