C21H24FNO2 — CID 71869222
N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-2,6-dimethylbenzamide (PubChem CID 71869222) has the molecular formula C21H24FNO2 and a molecular weight of 341.43 g/mol. Its IUPAC name is N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-2,6-dimethylbenzamide.
| Compound Name | N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-2,6-dimethylbenzamide |
|---|---|
| PubChem CID | 71869222 |
| Molecular Formula | C21H24FNO2 |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-2,6-dimethylbenzamide |
| SMILES | Cc1cccc(C)c1C(=O)NCC1(c2ccc(F)cc2)CCOCC1 |
| InChI | InChI=1S/C21H24FNO2/c1-15-4-3-5-16(2)19(15)20(24)23-14-21(10-12-25-13-11-21)17-6-8-18(22)9-7-17/h3-9H,10-14H2,1-2H3,(H,23,24) |
| InChIKey | PAWSHMYRNSVOGY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |