C19H18F3NO3 — CID 86861805
2,4-difluoro-N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-6-hydroxybenzamide (PubChem CID 86861805) has the molecular formula C19H18F3NO3 and a molecular weight of 365.35 g/mol. Its IUPAC name is 2,4-difluoro-N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-6-hydroxybenzamide.
| Compound Name | 2,4-difluoro-N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-6-hydroxybenzamide |
|---|---|
| PubChem CID | 86861805 |
| Molecular Formula | C19H18F3NO3 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 2,4-difluoro-N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-6-hydroxybenzamide |
| SMILES | O=C(NCC1(c2ccc(F)cc2)CCOCC1)c1c(O)cc(F)cc1F |
| InChI | InChI=1S/C19H18F3NO3/c20-13-3-1-12(2-4-13)19(5-7-26-8-6-19)11-23-18(25)17-15(22)9-14(21)10-16(17)24/h1-4,9-10,24H,5-8,11H2,(H,23,25) |
| InChIKey | CDKITWCUXKJJNX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |