C23H30FNO2 — CID 27450003
N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]adamantane-1-carboxamide (PubChem CID 27450003) has the molecular formula C23H30FNO2 and a molecular weight of 371.50 g/mol. Its IUPAC name is N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]adamantane-1-carboxamide.
| Compound Name | N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 27450003 |
| Molecular Formula | C23H30FNO2 |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]adamantane-1-carboxamide |
| SMILES | O=C(NCC1(c2ccc(F)cc2)CCOCC1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H30FNO2/c24-20-3-1-19(2-4-20)22(5-7-27-8-6-22)15-25-21(26)23-12-16-9-17(13-23)11-18(10-16)14-23/h1-4,16-18H,5-15H2,(H,25,26) |
| InChIKey | PLSAPMFXTVMNSL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |