C17H24FNO2S — CID 47070997
3-ethylsulfanyl-N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]propanamide (PubChem CID 47070997) has the molecular formula C17H24FNO2S and a molecular weight of 325.45 g/mol. Its IUPAC name is 3-ethylsulfanyl-N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]propanamide.
| Compound Name | 3-ethylsulfanyl-N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]propanamide |
|---|---|
| PubChem CID | 47070997 |
| Molecular Formula | C17H24FNO2S |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 3-ethylsulfanyl-N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]propanamide |
| SMILES | CCSCCC(=O)NCC1(c2ccc(F)cc2)CCOCC1 |
| InChI | InChI=1S/C17H24FNO2S/c1-2-22-12-7-16(20)19-13-17(8-10-21-11-9-17)14-3-5-15(18)6-4-14/h3-6H,2,7-13H2,1H3,(H,19,20) |
| InChIKey | QEXITOGXLVHKRV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|