C20H29FN2O2 — CID 71796603
1-cycloheptyl-3-[[4-(4-fluorophenyl)oxan-4-yl]methyl]urea (PubChem CID 71796603) has the molecular formula C20H29FN2O2 and a molecular weight of 348.46 g/mol. Its IUPAC name is 1-cycloheptyl-3-[[4-(4-fluorophenyl)oxan-4-yl]methyl]urea.
| Compound Name | 1-cycloheptyl-3-[[4-(4-fluorophenyl)oxan-4-yl]methyl]urea |
|---|---|
| PubChem CID | 71796603 |
| Molecular Formula | C20H29FN2O2 |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 1-cycloheptyl-3-[[4-(4-fluorophenyl)oxan-4-yl]methyl]urea |
| SMILES | O=C(NCC1(c2ccc(F)cc2)CCOCC1)NC1CCCCCC1 |
| InChI | InChI=1S/C20H29FN2O2/c21-17-9-7-16(8-10-17)20(11-13-25-14-12-20)15-22-19(24)23-18-5-3-1-2-4-6-18/h7-10,18H,1-6,11-15H2,(H2,22,23,24) |
| InChIKey | BWOASBATWZULCA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |