C20H30ClFN2O2 — CID 120789789
2-amino-N-[[1-(4-fluorophenyl)cyclohexyl]methyl]-2-(oxan-4-yl)acetamide;hydrochloride (PubChem CID 120789789) has the molecular formula C20H30ClFN2O2 and a molecular weight of 384.92 g/mol. Its IUPAC name is 2-amino-N-[[1-(4-fluorophenyl)cyclohexyl]methyl]-2-(oxan-4-yl)acetamide;hydrochloride.
| Compound Name | 2-amino-N-[[1-(4-fluorophenyl)cyclohexyl]methyl]-2-(oxan-4-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120789789 |
| Molecular Formula | C20H30ClFN2O2 |
| Molecular Weight | 384.92 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 2-amino-N-[[1-(4-fluorophenyl)cyclohexyl]methyl]-2-(oxan-4-yl)acetamide;hydrochloride |
| SMILES | Cl.NC(C(=O)NCC1(c2ccc(F)cc2)CCCCC1)C1CCOCC1 |
| InChI | InChI=1S/C20H29FN2O2.ClH/c21-17-6-4-16(5-7-17)20(10-2-1-3-11-20)14-23-19(24)18(22)15-8-12-25-13-9-15;/h4-7,15,18H,1-3,8-14,22H2,(H,23,24);1H |
| InChIKey | MDWZDJVAOFNKPE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.92 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |