C23H27F2N3O3 — CID 86874981
2-(3-fluorophenyl)-N-[2-[[4-(4-fluorophenyl)oxan-4-yl]methylcarbamoylamino]ethyl]acetamide (PubChem CID 86874981) has the molecular formula C23H27F2N3O3 and a molecular weight of 431.48 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-N-[2-[[4-(4-fluorophenyl)oxan-4-yl]methylcarbamoylamino]ethyl]acetamide.
| Compound Name | 2-(3-fluorophenyl)-N-[2-[[4-(4-fluorophenyl)oxan-4-yl]methylcarbamoylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 86874981 |
| Molecular Formula | C23H27F2N3O3 |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 2-(3-fluorophenyl)-N-[2-[[4-(4-fluorophenyl)oxan-4-yl]methylcarbamoylamino]ethyl]acetamide |
| SMILES | O=C(Cc1cccc(F)c1)NCCNC(=O)NCC1(c2ccc(F)cc2)CCOCC1 |
| InChI | InChI=1S/C23H27F2N3O3/c24-19-6-4-18(5-7-19)23(8-12-31-13-9-23)16-28-22(30)27-11-10-26-21(29)15-17-2-1-3-20(25)14-17/h1-7,14H,8-13,15-16H2,(H,26,29)(H2,27,28,30) |
| InChIKey | XFKHHGWCZVCIDR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|