C22H25BrFN3O3 — CID 60524701
N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-2-[(4-fluorophenyl)methylcarbamoylamino]acetamide (PubChem CID 60524701) has the molecular formula C22H25BrFN3O3 and a molecular weight of 478.36 g/mol. Its IUPAC name is N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-2-[(4-fluorophenyl)methylcarbamoylamino]acetamide.
| Compound Name | N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-2-[(4-fluorophenyl)methylcarbamoylamino]acetamide |
|---|---|
| PubChem CID | 60524701 |
| Molecular Formula | C22H25BrFN3O3 |
| Molecular Weight | 478.36 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-2-[(4-fluorophenyl)methylcarbamoylamino]acetamide |
| SMILES | O=C(CNC(=O)NCc1ccc(F)cc1)NCC1(c2cccc(Br)c2)CCOCC1 |
| InChI | InChI=1S/C22H25BrFN3O3/c23-18-3-1-2-17(12-18)22(8-10-30-11-9-22)15-27-20(28)14-26-21(29)25-13-16-4-6-19(24)7-5-16/h1-7,12H,8-11,13-15H2,(H,27,28)(H2,25,26,29) |
| InChIKey | BAWLOJCFNUUXMC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |