C22H22BrFN4O2 — CID 55890156
N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-1-(4-fluorophenyl)-5-methyltriazole-4-carboxamide (PubChem CID 55890156) has the molecular formula C22H22BrFN4O2 and a molecular weight of 473.35 g/mol. Its IUPAC name is N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-1-(4-fluorophenyl)-5-methyltriazole-4-carboxamide.
| Compound Name | N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-1-(4-fluorophenyl)-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 55890156 |
| Molecular Formula | C22H22BrFN4O2 |
| Molecular Weight | 473.35 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-1-(4-fluorophenyl)-5-methyltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCC2(c3cccc(Br)c3)CCOCC2)nnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H22BrFN4O2/c1-15-20(26-27-28(15)19-7-5-18(24)6-8-19)21(29)25-14-22(9-11-30-12-10-22)16-3-2-4-17(23)13-16/h2-8,13H,9-12,14H2,1H3,(H,25,29) |
| InChIKey | PEPWRZOKQKADNB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |