C18H20BrNO2S — CID 55865433
N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-5-methylthiophene-2-carboxamide (PubChem CID 55865433) has the molecular formula C18H20BrNO2S and a molecular weight of 394.33 g/mol. Its IUPAC name is N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-5-methylthiophene-2-carboxamide.
| Compound Name | N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 55865433 |
| Molecular Formula | C18H20BrNO2S |
| Molecular Weight | 394.33 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-5-methylthiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NCC2(c3cccc(Br)c3)CCOCC2)s1 |
| InChI | InChI=1S/C18H20BrNO2S/c1-13-5-6-16(23-13)17(21)20-12-18(7-9-22-10-8-18)14-3-2-4-15(19)11-14/h2-6,11H,7-10,12H2,1H3,(H,20,21) |
| InChIKey | QQJKMXSCCHZKOK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.33 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |