C18H28BrClN2O2 — CID 119738820
(2S)-2-amino-N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-4-methylpentanamide;hydrochloride (PubChem CID 119738820) has the molecular formula C18H28BrClN2O2 and a molecular weight of 419.79 g/mol. Its IUPAC name is (2S)-2-amino-N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-4-methylpentanamide;hydrochloride.
| Compound Name | (2S)-2-amino-N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-4-methylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 119738820 |
| Molecular Formula | C18H28BrClN2O2 |
| Molecular Weight | 419.79 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | (2S)-2-amino-N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-4-methylpentanamide;hydrochloride |
| SMILES | CC(C)C[C@H](N)C(=O)NCC1(c2cccc(Br)c2)CCOCC1.Cl |
| InChI | InChI=1S/C18H27BrN2O2.ClH/c1-13(2)10-16(20)17(22)21-12-18(6-8-23-9-7-18)14-4-3-5-15(19)11-14;/h3-5,11,13,16H,6-10,12,20H2,1-2H3,(H,21,22);1H/t16-;/m0./s1 |
| InChIKey | UZYJYVXAAUMPFH-NTISSMGPSA-N |
| XLogP | 3.41 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.79 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |