C15H21BrN2OS — CID 119325122
(2S)-2-amino-N-[[1-(3-bromophenyl)cyclopropyl]methyl]-4-methylsulfanylbutanamide (PubChem CID 119325122) has the molecular formula C15H21BrN2OS and a molecular weight of 357.32 g/mol. Its IUPAC name is (2S)-2-amino-N-[[1-(3-bromophenyl)cyclopropyl]methyl]-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-amino-N-[[1-(3-bromophenyl)cyclopropyl]methyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 119325122 |
| Molecular Formula | C15H21BrN2OS |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | (2S)-2-amino-N-[[1-(3-bromophenyl)cyclopropyl]methyl]-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](N)C(=O)NCC1(c2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C15H21BrN2OS/c1-20-8-5-13(17)14(19)18-10-15(6-7-15)11-3-2-4-12(16)9-11/h2-4,9,13H,5-8,10,17H2,1H3,(H,18,19)/t13-/m0/s1 |
| InChIKey | HZYKHPHXLTUASE-ZDUSSCGKSA-N |
| XLogP | 2.68 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |