C17H25BrN2OS — CID 119331509
(2S)-2-amino-N-[[1-(4-bromophenyl)cyclopentyl]methyl]-4-methylsulfanylbutanamide (PubChem CID 119331509) has the molecular formula C17H25BrN2OS and a molecular weight of 385.37 g/mol. Its IUPAC name is (2S)-2-amino-N-[[1-(4-bromophenyl)cyclopentyl]methyl]-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-amino-N-[[1-(4-bromophenyl)cyclopentyl]methyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 119331509 |
| Molecular Formula | C17H25BrN2OS |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | (2S)-2-amino-N-[[1-(4-bromophenyl)cyclopentyl]methyl]-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](N)C(=O)NCC1(c2ccc(Br)cc2)CCCC1 |
| InChI | InChI=1S/C17H25BrN2OS/c1-22-11-8-15(19)16(21)20-12-17(9-2-3-10-17)13-4-6-14(18)7-5-13/h4-7,15H,2-3,8-12,19H2,1H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | CZYVNRMDFFENOW-HNNXBMFYSA-N |
| XLogP | 3.46 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |