C23H28BrNO4 — CID 60524869
N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-3,4-diethoxybenzamide (PubChem CID 60524869) has the molecular formula C23H28BrNO4 and a molecular weight of 462.38 g/mol. Its IUPAC name is N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-3,4-diethoxybenzamide.
| Compound Name | N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 60524869 |
| Molecular Formula | C23H28BrNO4 |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NCC2(c3cccc(Br)c3)CCOCC2)cc1OCC |
| InChI | InChI=1S/C23H28BrNO4/c1-3-28-20-9-8-17(14-21(20)29-4-2)22(26)25-16-23(10-12-27-13-11-23)18-6-5-7-19(24)15-18/h5-9,14-15H,3-4,10-13,16H2,1-2H3,(H,25,26) |
| InChIKey | RUHLDRGLQZMUDJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |