C22H26BrNO2 — CID 60526265
N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-4-phenylbutanamide (PubChem CID 60526265) has the molecular formula C22H26BrNO2 and a molecular weight of 416.36 g/mol. Its IUPAC name is N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-4-phenylbutanamide.
| Compound Name | N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 60526265 |
| Molecular Formula | C22H26BrNO2 |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-4-phenylbutanamide |
| SMILES | O=C(CCCc1ccccc1)NCC1(c2cccc(Br)c2)CCOCC1 |
| InChI | InChI=1S/C22H26BrNO2/c23-20-10-5-9-19(16-20)22(12-14-26-15-13-22)17-24-21(25)11-4-8-18-6-2-1-3-7-18/h1-3,5-7,9-10,16H,4,8,11-15,17H2,(H,24,25) |
| InChIKey | GQOGHENLBPQRMR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |