C22H27NO3 — CID 27448950
N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-3-phenylpropanamide (PubChem CID 27448950) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-3-phenylpropanamide.
| Compound Name | N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 27448950 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-3-phenylpropanamide |
| SMILES | COc1ccc(C2(CNC(=O)CCc3ccccc3)CCOCC2)cc1 |
| InChI | InChI=1S/C22H27NO3/c1-25-20-10-8-19(9-11-20)22(13-15-26-16-14-22)17-23-21(24)12-7-18-5-3-2-4-6-18/h2-6,8-11H,7,12-17H2,1H3,(H,23,24) |
| InChIKey | DXTZDKBSHPPDFY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |