C27H29NO3S — CID 60578416
N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-2-phenyl-2-phenylsulfanylacetamide (PubChem CID 60578416) has the molecular formula C27H29NO3S and a molecular weight of 447.60 g/mol. Its IUPAC name is N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-2-phenyl-2-phenylsulfanylacetamide.
| Compound Name | N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-2-phenyl-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 60578416 |
| Molecular Formula | C27H29NO3S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-2-phenyl-2-phenylsulfanylacetamide |
| SMILES | COc1ccc(C2(CNC(=O)C(Sc3ccccc3)c3ccccc3)CCOCC2)cc1 |
| InChI | InChI=1S/C27H29NO3S/c1-30-23-14-12-22(13-15-23)27(16-18-31-19-17-27)20-28-26(29)25(21-8-4-2-5-9-21)32-24-10-6-3-7-11-24/h2-15,25H,16-20H2,1H3,(H,28,29) |
| InChIKey | KNCUVQDDEIXJGK-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |