C25H25NO2 — CID 113090745
N-[[1-(4-methoxyphenyl)cyclopropyl]methyl]-2,2-diphenylacetamide (PubChem CID 113090745) has the molecular formula C25H25NO2 and a molecular weight of 371.48 g/mol. Its IUPAC name is N-[[1-(4-methoxyphenyl)cyclopropyl]methyl]-2,2-diphenylacetamide.
| Compound Name | N-[[1-(4-methoxyphenyl)cyclopropyl]methyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 113090745 |
| Molecular Formula | C25H25NO2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | N-[[1-(4-methoxyphenyl)cyclopropyl]methyl]-2,2-diphenylacetamide |
| SMILES | COc1ccc(C2(CNC(=O)C(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C25H25NO2/c1-28-22-14-12-21(13-15-22)25(16-17-25)18-26-24(27)23(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-15,23H,16-18H2,1H3,(H,26,27) |
| InChIKey | QYQRVOGQKYDZSK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |