C18H28N2O2 — CID 113214648
3-[[1-(4-methoxyphenyl)cyclopropyl]methyl]-1,1-dipropylurea (PubChem CID 113214648) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 3-[[1-(4-methoxyphenyl)cyclopropyl]methyl]-1,1-dipropylurea.
| Compound Name | 3-[[1-(4-methoxyphenyl)cyclopropyl]methyl]-1,1-dipropylurea |
|---|---|
| PubChem CID | 113214648 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 3-[[1-(4-methoxyphenyl)cyclopropyl]methyl]-1,1-dipropylurea |
| SMILES | CCCN(CCC)C(=O)NCC1(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C18H28N2O2/c1-4-12-20(13-5-2)17(21)19-14-18(10-11-18)15-6-8-16(22-3)9-7-15/h6-9H,4-5,10-14H2,1-3H3,(H,19,21) |
| InChIKey | FFXFZUVXYKQFJM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |