C26H26ClNO2 — CID 60575805
N-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-2,2-diphenylacetamide (PubChem CID 60575805) has the molecular formula C26H26ClNO2 and a molecular weight of 419.95 g/mol. Its IUPAC name is N-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-2,2-diphenylacetamide.
| Compound Name | N-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 60575805 |
| Molecular Formula | C26H26ClNO2 |
| Molecular Weight | 419.95 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | N-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-2,2-diphenylacetamide |
| SMILES | O=C(NCC1(c2ccc(Cl)cc2)CCOCC1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H26ClNO2/c27-23-13-11-22(12-14-23)26(15-17-30-18-16-26)19-28-25(29)24(20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-14,24H,15-19H2,(H,28,29) |
| InChIKey | QAWMJQNGCNLWTC-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.95 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |