C17H22F4N2O3 — CID 86838192
1-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-3-[2-(2,2,2-trifluoroethoxy)ethyl]urea (PubChem CID 86838192) has the molecular formula C17H22F4N2O3 and a molecular weight of 378.37 g/mol. Its IUPAC name is 1-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-3-[2-(2,2,2-trifluoroethoxy)ethyl]urea.
| Compound Name | 1-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-3-[2-(2,2,2-trifluoroethoxy)ethyl]urea |
|---|---|
| PubChem CID | 86838192 |
| Molecular Formula | C17H22F4N2O3 |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 1-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-3-[2-(2,2,2-trifluoroethoxy)ethyl]urea |
| SMILES | O=C(NCCOCC(F)(F)F)NCC1(c2ccc(F)cc2)CCOCC1 |
| InChI | InChI=1S/C17H22F4N2O3/c18-14-3-1-13(2-4-14)16(5-8-25-9-6-16)11-23-15(24)22-7-10-26-12-17(19,20)21/h1-4H,5-12H2,(H2,22,23,24) |
| InChIKey | WESBBCBZUGAQFU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|