C25H34FIN4O2 — CID 111874210
4-[[[ethylamino-[[4-(4-fluorophenyl)oxan-4-yl]methylamino]methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide (PubChem CID 111874210) has the molecular formula C25H34FIN4O2 and a molecular weight of 568.48 g/mol. Its IUPAC name is 4-[[[ethylamino-[[4-(4-fluorophenyl)oxan-4-yl]methylamino]methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide.
| Compound Name | 4-[[[ethylamino-[[4-(4-fluorophenyl)oxan-4-yl]methylamino]methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111874210 |
| Molecular Formula | C25H34FIN4O2 |
| Molecular Weight | 568.48 g/mol |
| Exact Mass | 568.17 |
| IUPAC Name | 4-[[[ethylamino-[[4-(4-fluorophenyl)oxan-4-yl]methylamino]methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)N(C)C)cc1)NCC1(c2ccc(F)cc2)CCOCC1.I |
| InChI | InChI=1S/C25H33FN4O2.HI/c1-4-27-24(28-17-19-5-7-20(8-6-19)23(31)30(2)3)29-18-25(13-15-32-16-14-25)21-9-11-22(26)12-10-21;/h5-12H,4,13-18H2,1-3H3,(H2,27,28,29);1H |
| InChIKey | VBCYDAWKRHPWPJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|