C23H34FIN4O2 — CID 111592642
2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[[4-(4-fluorophenyl)oxan-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111592642) has the molecular formula C23H34FIN4O2 and a molecular weight of 544.45 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[[4-(4-fluorophenyl)oxan-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[[4-(4-fluorophenyl)oxan-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111592642 |
| Molecular Formula | C23H34FIN4O2 |
| Molecular Weight | 544.45 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[[4-(4-fluorophenyl)oxan-4-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncc(C(C)(C)C)o1)NCC1(c2ccc(F)cc2)CCOCC1.I |
| InChI | InChI=1S/C23H33FN4O2.HI/c1-5-25-21(27-15-20-26-14-19(30-20)22(2,3)4)28-16-23(10-12-29-13-11-23)17-6-8-18(24)9-7-17;/h6-9,14H,5,10-13,15-16H2,1-4H3,(H2,25,27,28);1H |
| InChIKey | ZIIJJBPBJWEGTL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|