C22H26F3N3O — CID 111902565
2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[[4-(4-fluorophenyl)oxan-4-yl]methyl]guanidine (PubChem CID 111902565) has the molecular formula C22H26F3N3O and a molecular weight of 405.46 g/mol. Its IUPAC name is 2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[[4-(4-fluorophenyl)oxan-4-yl]methyl]guanidine.
| Compound Name | 2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[[4-(4-fluorophenyl)oxan-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111902565 |
| Molecular Formula | C22H26F3N3O |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[[4-(4-fluorophenyl)oxan-4-yl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc(F)ccc1F)NCC1(c2ccc(F)cc2)CCOCC1 |
| InChI | InChI=1S/C22H26F3N3O/c1-2-26-21(27-14-16-13-19(24)7-8-20(16)25)28-15-22(9-11-29-12-10-22)17-3-5-18(23)6-4-17/h3-8,13H,2,9-12,14-15H2,1H3,(H2,26,27,28) |
| InChIKey | ICLBVIGLYRBCSE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|