C22H28FN3O — CID 111266997
1-ethyl-2-[(2-fluorophenyl)methyl]-3-[(4-phenyloxan-4-yl)methyl]guanidine (PubChem CID 111266997) has the molecular formula C22H28FN3O and a molecular weight of 369.48 g/mol. Its IUPAC name is 1-ethyl-2-[(2-fluorophenyl)methyl]-3-[(4-phenyloxan-4-yl)methyl]guanidine.
| Compound Name | 1-ethyl-2-[(2-fluorophenyl)methyl]-3-[(4-phenyloxan-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111266997 |
| Molecular Formula | C22H28FN3O |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 1-ethyl-2-[(2-fluorophenyl)methyl]-3-[(4-phenyloxan-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1F)NCC1(c2ccccc2)CCOCC1 |
| InChI | InChI=1S/C22H28FN3O/c1-2-24-21(25-16-18-8-6-7-11-20(18)23)26-17-22(12-14-27-15-13-22)19-9-4-3-5-10-19/h3-11H,2,12-17H2,1H3,(H2,24,25,26) |
| InChIKey | NPBRKHQPSUCRER-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|