C24H34FIN4O — CID 111829820
1-ethyl-2-[(2-fluorophenyl)methyl]-3-[[4-(1-phenylethylamino)oxan-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111829820) has the molecular formula C24H34FIN4O and a molecular weight of 540.47 g/mol. Its IUPAC name is 1-ethyl-2-[(2-fluorophenyl)methyl]-3-[[4-(1-phenylethylamino)oxan-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(2-fluorophenyl)methyl]-3-[[4-(1-phenylethylamino)oxan-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111829820 |
| Molecular Formula | C24H34FIN4O |
| Molecular Weight | 540.47 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | 1-ethyl-2-[(2-fluorophenyl)methyl]-3-[[4-(1-phenylethylamino)oxan-4-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1F)NCC1(NC(C)c2ccccc2)CCOCC1.I |
| InChI | InChI=1S/C24H33FN4O.HI/c1-3-26-23(27-17-21-11-7-8-12-22(21)25)28-18-24(13-15-30-16-14-24)29-19(2)20-9-5-4-6-10-20;/h4-12,19,29H,3,13-18H2,1-2H3,(H2,26,27,28);1H |
| InChIKey | JCRITPNWUJEWHZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 57.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|