C24H33FN4O — CID 111831250
1-[2-(2-fluorophenyl)ethyl]-2-methyl-3-[[4-(1-phenylethylamino)oxan-4-yl]methyl]guanidine (PubChem CID 111831250) has the molecular formula C24H33FN4O and a molecular weight of 412.55 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)ethyl]-2-methyl-3-[[4-(1-phenylethylamino)oxan-4-yl]methyl]guanidine.
| Compound Name | 1-[2-(2-fluorophenyl)ethyl]-2-methyl-3-[[4-(1-phenylethylamino)oxan-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111831250 |
| Molecular Formula | C24H33FN4O |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 1-[2-(2-fluorophenyl)ethyl]-2-methyl-3-[[4-(1-phenylethylamino)oxan-4-yl]methyl]guanidine |
| SMILES | C/N=C(\NCCc1ccccc1F)NCC1(NC(C)c2ccccc2)CCOCC1 |
| InChI | InChI=1S/C24H33FN4O/c1-19(20-8-4-3-5-9-20)29-24(13-16-30-17-14-24)18-28-23(26-2)27-15-12-21-10-6-7-11-22(21)25/h3-11,19,29H,12-18H2,1-2H3,(H2,26,27,28) |
| InChIKey | FQGOLPXOAACFPA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 57.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|