C24H32F3IN4O — CID 111832500
2-methyl-1-[[4-(1-phenylethylamino)oxan-4-yl]methyl]-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111832500) has the molecular formula C24H32F3IN4O and a molecular weight of 576.45 g/mol. Its IUPAC name is 2-methyl-1-[[4-(1-phenylethylamino)oxan-4-yl]methyl]-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[4-(1-phenylethylamino)oxan-4-yl]methyl]-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111832500 |
| Molecular Formula | C24H32F3IN4O |
| Molecular Weight | 576.45 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | 2-methyl-1-[[4-(1-phenylethylamino)oxan-4-yl]methyl]-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(C(F)(F)F)cc1)NCC1(NC(C)c2ccccc2)CCOCC1.I |
| InChI | InChI=1S/C24H31F3N4O.HI/c1-18(20-6-4-3-5-7-20)31-23(12-14-32-15-13-23)17-30-22(28-2)29-16-19-8-10-21(11-9-19)24(25,26)27;/h3-11,18,31H,12-17H2,1-2H3,(H2,28,29,30);1H |
| InChIKey | KZXLLAMYGFJNTR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 57.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|