C22H27F2N3O — CID 111903023
2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[(4-phenyloxan-4-yl)methyl]guanidine (PubChem CID 111903023) has the molecular formula C22H27F2N3O and a molecular weight of 387.47 g/mol. Its IUPAC name is 2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[(4-phenyloxan-4-yl)methyl]guanidine.
| Compound Name | 2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[(4-phenyloxan-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111903023 |
| Molecular Formula | C22H27F2N3O |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[(4-phenyloxan-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc(F)ccc1F)NCC1(c2ccccc2)CCOCC1 |
| InChI | InChI=1S/C22H27F2N3O/c1-2-25-21(26-15-17-14-19(23)8-9-20(17)24)27-16-22(10-12-28-13-11-22)18-6-4-3-5-7-18/h3-9,14H,2,10-13,15-16H2,1H3,(H2,25,26,27) |
| InChIKey | ZYCYEIBPKKATMU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|